C15H17BrN4OS — CID 8983107
4-bromo-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]-1H-pyrrole-2-carboxamide (PubChem CID 8983107) has the molecular formula C15H17BrN4OS and a molecular weight of 381.30 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 8983107 |
| Molecular Formula | C15H17BrN4OS |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 4-bromo-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(N2CCCCC2)s1)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C15H17BrN4OS/c16-11-8-13(17-9-11)15(21)19-18-10-12-4-5-14(22-12)20-6-2-1-3-7-20/h4-5,8-10,17H,1-3,6-7H2,(H,19,21)/b18-10- |
| InChIKey | CTOOSOSOIVKQOF-ZDLGFXPLSA-N |
| XLogP | 3.59 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|