C18H22N4O3S2 — CID 9237380
2-(benzenesulfonamido)-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]acetamide (PubChem CID 9237380) has the molecular formula C18H22N4O3S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 9237380 |
| Molecular Formula | C18H22N4O3S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)N/N=C\c1ccc(N2CCCCC2)s1 |
| InChI | InChI=1S/C18H22N4O3S2/c23-17(14-20-27(24,25)16-7-3-1-4-8-16)21-19-13-15-9-10-18(26-15)22-11-5-2-6-12-22/h1,3-4,7-10,13,20H,2,5-6,11-12,14H2,(H,21,23)/b19-13- |
| InChIKey | RDEJSHNGBUYIRL-UYRXBGFRSA-N |
| XLogP | 2.17 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|