C17H18N4O4S — CID 44592036
2-[(4-acetamidophenyl)sulfonylamino]-N-[(E)-benzylideneamino]acetamide (PubChem CID 44592036) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonylamino]-N-[(E)-benzylideneamino]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonylamino]-N-[(E)-benzylideneamino]acetamide |
|---|---|
| PubChem CID | 44592036 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonylamino]-N-[(E)-benzylideneamino]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCC(=O)N/N=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N4O4S/c1-13(22)20-15-7-9-16(10-8-15)26(24,25)19-12-17(23)21-18-11-14-5-3-2-4-6-14/h2-11,19H,12H2,1H3,(H,20,22)(H,21,23)/b18-11+ |
| InChIKey | FOKVGZKVMCUXLH-WOJGMQOQSA-N |
| XLogP | 1.07 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|