C18H19N3O6S — CID 7826786
(2-anilino-2-oxoethyl) 2-[(4-acetamidophenyl)sulfonylamino]acetate (PubChem CID 7826786) has the molecular formula C18H19N3O6S and a molecular weight of 405.43 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 2-[(4-acetamidophenyl)sulfonylamino]acetate.
| Compound Name | (2-anilino-2-oxoethyl) 2-[(4-acetamidophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7826786 |
| Molecular Formula | C18H19N3O6S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (2-anilino-2-oxoethyl) 2-[(4-acetamidophenyl)sulfonylamino]acetate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCC(=O)OCC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N3O6S/c1-13(22)20-15-7-9-16(10-8-15)28(25,26)19-11-18(24)27-12-17(23)21-14-5-3-2-4-6-14/h2-10,19H,11-12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | FXZDDFSSUGTXKL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |