C14H19N3O6S — CID 7826725
[2-(dimethylamino)-2-oxoethyl] 2-[(4-acetamidophenyl)sulfonylamino]acetate (PubChem CID 7826725) has the molecular formula C14H19N3O6S and a molecular weight of 357.39 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] 2-[(4-acetamidophenyl)sulfonylamino]acetate.
| Compound Name | [2-(dimethylamino)-2-oxoethyl] 2-[(4-acetamidophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7826725 |
| Molecular Formula | C14H19N3O6S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] 2-[(4-acetamidophenyl)sulfonylamino]acetate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCC(=O)OCC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C14H19N3O6S/c1-10(18)16-11-4-6-12(7-5-11)24(21,22)15-8-14(20)23-9-13(19)17(2)3/h4-7,15H,8-9H2,1-3H3,(H,16,18) |
| InChIKey | SXMJHWVNXLZVGQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |