C10H13N3O3S2 — CID 61127681
N-[4-[(2-amino-2-sulfanylideneethyl)sulfamoyl]phenyl]acetamide (PubChem CID 61127681) has the molecular formula C10H13N3O3S2 and a molecular weight of 287.37 g/mol. Its IUPAC name is N-[4-[(2-amino-2-sulfanylideneethyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(2-amino-2-sulfanylideneethyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 61127681 |
| Molecular Formula | C10H13N3O3S2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | N-[4-[(2-amino-2-sulfanylideneethyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCC(N)=S)cc1 |
| InChI | InChI=1S/C10H13N3O3S2/c1-7(14)13-8-2-4-9(5-3-8)18(15,16)12-6-10(11)17/h2-5,12H,6H2,1H3,(H2,11,17)(H,13,14) |
| InChIKey | DFPZRINHCWGGSL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|