C11H12N2O3S — CID 9356086
N-[4-(prop-2-ynylsulfamoyl)phenyl]acetamide (PubChem CID 9356086) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is N-[4-(prop-2-ynylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[4-(prop-2-ynylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9356086 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | N-[4-(prop-2-ynylsulfamoyl)phenyl]acetamide |
| SMILES | C#CCNS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C11H12N2O3S/c1-3-8-12-17(15,16)11-6-4-10(5-7-11)13-9(2)14/h1,4-7,12H,8H2,2H3,(H,13,14) |
| InChIKey | ZBEDVEMVIJORPJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|