C11H16N2O5S — CID 66176694
N-[4-(2,3-dihydroxypropylsulfamoyl)phenyl]acetamide (PubChem CID 66176694) has the molecular formula C11H16N2O5S and a molecular weight of 288.33 g/mol. Its IUPAC name is N-[4-(2,3-dihydroxypropylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[4-(2,3-dihydroxypropylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 66176694 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-[4-(2,3-dihydroxypropylsulfamoyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCC(O)CO)cc1 |
| InChI | InChI=1S/C11H16N2O5S/c1-8(15)13-9-2-4-11(5-3-9)19(17,18)12-6-10(16)7-14/h2-5,10,12,14,16H,6-7H2,1H3,(H,13,15) |
| InChIKey | VHERPOXIKHWAMM-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |