C12H15N2O5S- — CID 2385404
4-[(4-acetamidophenyl)sulfonylamino]butanoate (PubChem CID 2385404) has the molecular formula C12H15N2O5S- and a molecular weight of 299.33 g/mol. Its IUPAC name is 4-[(4-acetamidophenyl)sulfonylamino]butanoate.
| Compound Name | 4-[(4-acetamidophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 2385404 |
| Molecular Formula | C12H15N2O5S- |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-[(4-acetamidophenyl)sulfonylamino]butanoate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCCC(=O)[O-])cc1 |
| InChI | InChI=1S/C12H16N2O5S/c1-9(15)14-10-4-6-11(7-5-10)20(18,19)13-8-2-3-12(16)17/h4-7,13H,2-3,8H2,1H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | OUVNEDIUOZRZKP-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|