C14H18N2O3S — CID 103756998
N-[4-(hex-5-ynylsulfamoyl)phenyl]acetamide (PubChem CID 103756998) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is N-[4-(hex-5-ynylsulfamoyl)phenyl]acetamide.
| Compound Name | N-[4-(hex-5-ynylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 103756998 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | N-[4-(hex-5-ynylsulfamoyl)phenyl]acetamide |
| SMILES | C#CCCCCNS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C14H18N2O3S/c1-3-4-5-6-11-15-20(18,19)14-9-7-13(8-10-14)16-12(2)17/h1,7-10,15H,4-6,11H2,2H3,(H,16,17) |
| InChIKey | SWBXSXGFJYYWKI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|