C11H11NO6S-2 — CID 2141978
4-(3-carboxylatopropylsulfamoyl)benzoate (PubChem CID 2141978) has the molecular formula C11H11NO6S-2 and a molecular weight of 285.28 g/mol. Its IUPAC name is 4-(3-carboxylatopropylsulfamoyl)benzoate.
| Compound Name | 4-(3-carboxylatopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2141978 |
| Molecular Formula | C11H11NO6S-2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 4-(3-carboxylatopropylsulfamoyl)benzoate |
| SMILES | O=C([O-])CCCNS(=O)(=O)c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C11H13NO6S/c13-10(14)2-1-7-12-19(17,18)9-5-3-8(4-6-9)11(15)16/h3-6,12H,1-2,7H2,(H,13,14)(H,15,16)/p-2 |
| InChIKey | MDXNBESEAZKLMT-UHFFFAOYSA-L |
| XLogP | -2.14 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|