C18H20N3O4S- — CID 9012893
4-[(2Z)-2-[1-[4-(propylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoate (PubChem CID 9012893) has the molecular formula C18H20N3O4S- and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-[(2Z)-2-[1-[4-(propylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoate.
| Compound Name | 4-[(2Z)-2-[1-[4-(propylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 9012893 |
| Molecular Formula | C18H20N3O4S- |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-[(2Z)-2-[1-[4-(propylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoate |
| SMILES | CCCNS(=O)(=O)c1ccc(/C(C)=N\Nc2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H21N3O4S/c1-3-12-19-26(24,25)17-10-6-14(7-11-17)13(2)20-21-16-8-4-15(5-9-16)18(22)23/h4-11,19,21H,3,12H2,1-2H3,(H,22,23)/p-1/b20-13- |
| InChIKey | QGLQBTMKYGPHAN-MOSHPQCFSA-M |
| XLogP | 1.57 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|