C18H19N2O3- — CID 9012896
4-[(2Z)-2-[1-(4-propoxyphenyl)ethylidene]hydrazinyl]benzoate (PubChem CID 9012896) has the molecular formula C18H19N2O3- and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-[(2Z)-2-[1-(4-propoxyphenyl)ethylidene]hydrazinyl]benzoate.
| Compound Name | 4-[(2Z)-2-[1-(4-propoxyphenyl)ethylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 9012896 |
| Molecular Formula | C18H19N2O3- |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 4-[(2Z)-2-[1-(4-propoxyphenyl)ethylidene]hydrazinyl]benzoate |
| SMILES | CCCOc1ccc(/C(C)=N\Nc2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H20N2O3/c1-3-12-23-17-10-6-14(7-11-17)13(2)19-20-16-8-4-15(5-9-16)18(21)22/h4-11,20H,3,12H2,1-2H3,(H,21,22)/p-1/b19-13- |
| InChIKey | YQSBDEPHFPPXDC-UYRXBGFRSA-M |
| XLogP | 2.67 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|