C17H17N2O3- — CID 9012884
4-[(2Z)-2-[1-(2-ethoxyphenyl)ethylidene]hydrazinyl]benzoate (PubChem CID 9012884) has the molecular formula C17H17N2O3- and a molecular weight of 297.33 g/mol. Its IUPAC name is 4-[(2Z)-2-[1-(2-ethoxyphenyl)ethylidene]hydrazinyl]benzoate.
| Compound Name | 4-[(2Z)-2-[1-(2-ethoxyphenyl)ethylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 9012884 |
| Molecular Formula | C17H17N2O3- |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-[(2Z)-2-[1-(2-ethoxyphenyl)ethylidene]hydrazinyl]benzoate |
| SMILES | CCOc1ccccc1/C(C)=N\Nc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N2O3/c1-3-22-16-7-5-4-6-15(16)12(2)18-19-14-10-8-13(9-11-14)17(20)21/h4-11,19H,3H2,1-2H3,(H,20,21)/p-1/b18-12- |
| InChIKey | PZATYGWFIPCHQQ-PDGQHHTCSA-M |
| XLogP | 2.28 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|