C16H13F2N2O3- — CID 8007668
4-[(2Z)-2-[1-[2-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]benzoate (PubChem CID 8007668) has the molecular formula C16H13F2N2O3- and a molecular weight of 319.29 g/mol. Its IUPAC name is 4-[(2Z)-2-[1-[2-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]benzoate.
| Compound Name | 4-[(2Z)-2-[1-[2-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 8007668 |
| Molecular Formula | C16H13F2N2O3- |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 4-[(2Z)-2-[1-[2-(difluoromethoxy)phenyl]ethylidene]hydrazinyl]benzoate |
| SMILES | C/C(=N/Nc1ccc(C(=O)[O-])cc1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C16H14F2N2O3/c1-10(13-4-2-3-5-14(13)23-16(17)18)19-20-12-8-6-11(7-9-12)15(21)22/h2-9,16,20H,1H3,(H,21,22)/p-1/b19-10- |
| InChIKey | RZANSHZRRHMYNH-GRSHGNNSSA-M |
| XLogP | 2.49 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|