C17H17N2O4- — CID 7734089
4-[(2Z)-2-[1-(2,5-dimethoxyphenyl)ethylidene]hydrazinyl]benzoate (PubChem CID 7734089) has the molecular formula C17H17N2O4- and a molecular weight of 313.33 g/mol. Its IUPAC name is 4-[(2Z)-2-[1-(2,5-dimethoxyphenyl)ethylidene]hydrazinyl]benzoate.
| Compound Name | 4-[(2Z)-2-[1-(2,5-dimethoxyphenyl)ethylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7734089 |
| Molecular Formula | C17H17N2O4- |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 4-[(2Z)-2-[1-(2,5-dimethoxyphenyl)ethylidene]hydrazinyl]benzoate |
| SMILES | COc1ccc(OC)c(/C(C)=N\Nc2ccc(C(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C17H18N2O4/c1-11(15-10-14(22-2)8-9-16(15)23-3)18-19-13-6-4-12(5-7-13)17(20)21/h4-10,19H,1-3H3,(H,20,21)/p-1/b18-11- |
| InChIKey | KGFDFYFXZGMXLF-WQRHYEAKSA-M |
| XLogP | 1.90 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|