C18H20N2O5 — CID 4005334
4-[2-[1-(2,4,6-trimethoxyphenyl)ethylidene]hydrazinyl]benzoic acid (PubChem CID 4005334) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 4-[2-[1-(2,4,6-trimethoxyphenyl)ethylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[2-[1-(2,4,6-trimethoxyphenyl)ethylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 4005334 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-[2-[1-(2,4,6-trimethoxyphenyl)ethylidene]hydrazinyl]benzoic acid |
| SMILES | COc1cc(OC)c(C(C)=NNc2ccc(C(=O)O)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H20N2O5/c1-11(19-20-13-7-5-12(6-8-13)18(21)22)17-15(24-3)9-14(23-2)10-16(17)25-4/h5-10,20H,1-4H3,(H,21,22) |
| InChIKey | VGEUHFOJTPCXIK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|