C18H17F3N2O4 — CID 137084062
N-[1-(2-hydroxy-4,6-dimethoxyphenyl)ethylideneamino]-4-(trifluoromethyl)benzamide (PubChem CID 137084062) has the molecular formula C18H17F3N2O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is N-[1-(2-hydroxy-4,6-dimethoxyphenyl)ethylideneamino]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(2-hydroxy-4,6-dimethoxyphenyl)ethylideneamino]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 137084062 |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-[1-(2-hydroxy-4,6-dimethoxyphenyl)ethylideneamino]-4-(trifluoromethyl)benzamide |
| SMILES | COc1cc(O)c(C(C)=NNC(=O)c2ccc(C(F)(F)F)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H17F3N2O4/c1-10(16-14(24)8-13(26-2)9-15(16)27-3)22-23-17(25)11-4-6-12(7-5-11)18(19,20)21/h4-9,24H,1-3H3,(H,23,25) |
| InChIKey | AECBYDYHKPBOPH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|