C17H14F3IN2O — CID 164621332
3-iodo-4-methyl-N-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]benzamide (PubChem CID 164621332) has the molecular formula C17H14F3IN2O and a molecular weight of 446.21 g/mol. Its IUPAC name is 3-iodo-4-methyl-N-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]benzamide.
| Compound Name | 3-iodo-4-methyl-N-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 164621332 |
| Molecular Formula | C17H14F3IN2O |
| Molecular Weight | 446.21 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 3-iodo-4-methyl-N-[(E)-1-[4-(trifluoromethyl)phenyl]ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(C)c(I)c1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3IN2O/c1-10-3-4-13(9-15(10)21)16(24)23-22-11(2)12-5-7-14(8-6-12)17(18,19)20/h3-9H,1-2H3,(H,23,24)/b22-11+ |
| InChIKey | KGPFOSIOSCQSCH-SSDVNMTOSA-N |
| XLogP | 4.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.21 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|