C12H13F3N2O2 — CID 3787588
ethyl N-[4-(trifluoromethyl)benzoyl]ethanehydrazonate (PubChem CID 3787588) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is ethyl N-[4-(trifluoromethyl)benzoyl]ethanehydrazonate.
| Compound Name | ethyl N-[4-(trifluoromethyl)benzoyl]ethanehydrazonate |
|---|---|
| PubChem CID | 3787588 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | ethyl N-[4-(trifluoromethyl)benzoyl]ethanehydrazonate |
| SMILES | CCOC(C)=NNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O2/c1-3-19-8(2)16-17-11(18)9-4-6-10(7-5-9)12(13,14)15/h4-7H,3H2,1-2H3,(H,17,18) |
| InChIKey | GPERAPHAUXRALL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|