C14H13F3O4 — CID 98044853
ethyl (3S)-3-methyl-2,4-dioxo-4-[4-(trifluoromethyl)phenyl]butanoate (PubChem CID 98044853) has the molecular formula C14H13F3O4 and a molecular weight of 302.25 g/mol. Its IUPAC name is ethyl (3S)-3-methyl-2,4-dioxo-4-[4-(trifluoromethyl)phenyl]butanoate.
| Compound Name | ethyl (3S)-3-methyl-2,4-dioxo-4-[4-(trifluoromethyl)phenyl]butanoate |
|---|---|
| PubChem CID | 98044853 |
| Molecular Formula | C14H13F3O4 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | ethyl (3S)-3-methyl-2,4-dioxo-4-[4-(trifluoromethyl)phenyl]butanoate |
| SMILES | CCOC(=O)C(=O)[C@@H](C)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3O4/c1-3-21-13(20)12(19)8(2)11(18)9-4-6-10(7-5-9)14(15,16)17/h4-8H,3H2,1-2H3/t8-/m0/s1 |
| InChIKey | VOYYSKVIYBQRRG-QMMMGPOBSA-N |
| XLogP | 2.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|