C17H22O5 — CID 54803727
ethyl 4-(4-butan-2-yloxyphenyl)-3-methyl-2,4-dioxobutanoate (PubChem CID 54803727) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is ethyl 4-(4-butan-2-yloxyphenyl)-3-methyl-2,4-dioxobutanoate.
| Compound Name | ethyl 4-(4-butan-2-yloxyphenyl)-3-methyl-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 54803727 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | ethyl 4-(4-butan-2-yloxyphenyl)-3-methyl-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)C(C)C(=O)c1ccc(OC(C)CC)cc1 |
| InChI | InChI=1S/C17H22O5/c1-5-11(3)22-14-9-7-13(8-10-14)15(18)12(4)16(19)17(20)21-6-2/h7-12H,5-6H2,1-4H3 |
| InChIKey | JDCUPKAYFNHNPV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|