About 4-butan-2-yloxyaniline
4-butan-2-yloxyaniline (PubChem CID 13097722) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-butan-2-yloxyaniline.
Molecular Properties
| Compound Name | 4-butan-2-yloxyaniline |
| PubChem CID | 13097722 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 4-butan-2-yloxyaniline |
| SMILES | CCC(C)Oc1ccc(N)cc1 |
| InChI | InChI=1S/C10H15NO/c1-3-8(2)12-10-6-4-9(11)5-7-10/h4-8H,3,11H2,1-2H3 |
| InChIKey | KBARUYSFNLJALB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-butan-2-yloxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yloxyaniline?
The IUPAC name of 4-butan-2-yloxyaniline (CID 13097722) is 4-butan-2-yloxyaniline.
What is the SMILES notation for 4-butan-2-yloxyaniline?
The canonical SMILES for 4-butan-2-yloxyaniline is CCC(C)Oc1ccc(N)cc1.
What is the InChIKey of 4-butan-2-yloxyaniline?
The InChIKey is KBARUYSFNLJALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-3-8(2)12-10-6-4-9(11)5-7-10/h4-8H,3,11H2,1-2H3.
What are the key properties of 4-butan-2-yloxyaniline?
4-butan-2-yloxyaniline has a molecular weight of 165.24 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yloxyaniline is sourced from PubChem (CID 13097722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).