C9H10F3NO — CID 66580012
4-[(2R)-1,1,1-trifluoropropan-2-yl]oxyaniline (PubChem CID 66580012) has the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. Its IUPAC name is 4-[(2R)-1,1,1-trifluoropropan-2-yl]oxyaniline.
| Compound Name | 4-[(2R)-1,1,1-trifluoropropan-2-yl]oxyaniline |
|---|---|
| PubChem CID | 66580012 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-[(2R)-1,1,1-trifluoropropan-2-yl]oxyaniline |
| SMILES | C[C@@H](Oc1ccc(N)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO/c1-6(9(10,11)12)14-8-4-2-7(13)3-5-8/h2-6H,13H2,1H3/t6-/m1/s1 |
| InChIKey | LRLUOCMEXLQOGO-ZCFIWIBFSA-N |
| XLogP | 2.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|