C11H14F3NO — CID 66274601
1-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]ethanamine (PubChem CID 66274601) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]ethanamine.
| Compound Name | 1-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 66274601 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-[4-(1,1,1-trifluoropropan-2-yloxy)phenyl]ethanamine |
| SMILES | CC(N)c1ccc(OC(C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NO/c1-7(15)9-3-5-10(6-4-9)16-8(2)11(12,13)14/h3-8H,15H2,1-2H3 |
| InChIKey | XGVOBYHJSBMANR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |