C11H14F3NO2 — CID 63900014
3-[4-[(1S)-1-aminoethyl]phenoxy]-1,1,1-trifluoropropan-2-ol (PubChem CID 63900014) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 3-[4-[(1S)-1-aminoethyl]phenoxy]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[4-[(1S)-1-aminoethyl]phenoxy]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 63900014 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-[4-[(1S)-1-aminoethyl]phenoxy]-1,1,1-trifluoropropan-2-ol |
| SMILES | C[C@H](N)c1ccc(OCC(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NO2/c1-7(15)8-2-4-9(5-3-8)17-6-10(16)11(12,13)14/h2-5,7,10,16H,6,15H2,1H3/t7-,10?/m0/s1 |
| InChIKey | UZJBDFPFTJYMFS-BYDSUWOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |