C14H23NO3 — CID 63988221
1-[4-[(1S)-1-aminoethyl]phenoxy]-3-propan-2-yloxypropan-2-ol (PubChem CID 63988221) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-[4-[(1S)-1-aminoethyl]phenoxy]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[4-[(1S)-1-aminoethyl]phenoxy]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 63988221 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-[4-[(1S)-1-aminoethyl]phenoxy]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OCC(O)COc1ccc([C@H](C)N)cc1 |
| InChI | InChI=1S/C14H23NO3/c1-10(2)17-8-13(16)9-18-14-6-4-12(5-7-14)11(3)15/h4-7,10-11,13,16H,8-9,15H2,1-3H3/t11-,13?/m0/s1 |
| InChIKey | XMKSYWWNNFDRTH-AMGKYWFPSA-N |
| XLogP | 1.87 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |