C13H20O4 — CID 78954639
1-ethoxy-3-[4-[(1R)-1-hydroxyethyl]phenoxy]propan-2-ol (PubChem CID 78954639) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 1-ethoxy-3-[4-[(1R)-1-hydroxyethyl]phenoxy]propan-2-ol.
| Compound Name | 1-ethoxy-3-[4-[(1R)-1-hydroxyethyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 78954639 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-ethoxy-3-[4-[(1R)-1-hydroxyethyl]phenoxy]propan-2-ol |
| SMILES | CCOCC(O)COc1ccc([C@@H](C)O)cc1 |
| InChI | InChI=1S/C13H20O4/c1-3-16-8-12(15)9-17-13-6-4-11(5-7-13)10(2)14/h4-7,10,12,14-15H,3,8-9H2,1-2H3/t10-,12?/m1/s1 |
| InChIKey | WHXSVYUJQRYLPZ-RWANSRKNSA-N |
| XLogP | 1.52 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |