C14H22O4 — CID 104928926
(1S)-1-[4-(2,2-diethoxyethoxy)phenyl]ethanol (PubChem CID 104928926) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (1S)-1-[4-(2,2-diethoxyethoxy)phenyl]ethanol.
| Compound Name | (1S)-1-[4-(2,2-diethoxyethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 104928926 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (1S)-1-[4-(2,2-diethoxyethoxy)phenyl]ethanol |
| SMILES | CCOC(COc1ccc([C@H](C)O)cc1)OCC |
| InChI | InChI=1S/C14H22O4/c1-4-16-14(17-5-2)10-18-13-8-6-12(7-9-13)11(3)15/h6-9,11,14-15H,4-5,10H2,1-3H3/t11-/m0/s1 |
| InChIKey | TZPXVXVEAZBZCC-NSHDSACASA-N |
| XLogP | 2.52 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|