C14H22O4 — CID 63629434
1-(2,2-diethoxyethoxy)-4-ethoxybenzene (PubChem CID 63629434) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-(2,2-diethoxyethoxy)-4-ethoxybenzene.
| Compound Name | 1-(2,2-diethoxyethoxy)-4-ethoxybenzene |
|---|---|
| PubChem CID | 63629434 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-(2,2-diethoxyethoxy)-4-ethoxybenzene |
| SMILES | CCOc1ccc(OCC(OCC)OCC)cc1 |
| InChI | InChI=1S/C14H22O4/c1-4-15-12-7-9-13(10-8-12)18-11-14(16-5-2)17-6-3/h7-10,14H,4-6,11H2,1-3H3 |
| InChIKey | YOPYEHCNQZWREJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|