C17H26O6 — CID 70033606
3-[4-(2,2-diethoxyethoxy)phenyl]-2-ethoxypropanoic acid (PubChem CID 70033606) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is 3-[4-(2,2-diethoxyethoxy)phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-(2,2-diethoxyethoxy)phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 70033606 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-[4-(2,2-diethoxyethoxy)phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(COc1ccc(CC(OCC)C(=O)O)cc1)OCC |
| InChI | InChI=1S/C17H26O6/c1-4-20-15(17(18)19)11-13-7-9-14(10-8-13)23-12-16(21-5-2)22-6-3/h7-10,15-16H,4-6,11-12H2,1-3H3,(H,18,19) |
| InChIKey | QDFBCBMPQHBNSR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|