C20H26ClNO4 — CID 69426610
[4-[3-[4-[(2S)-2-carboxy-2-ethoxyethyl]phenoxy]propyl]phenyl]azanium chloride (PubChem CID 69426610) has the molecular formula C20H26ClNO4 and a molecular weight of 379.88 g/mol. Its IUPAC name is [4-[3-[4-[(2S)-2-carboxy-2-ethoxyethyl]phenoxy]propyl]phenyl]azanium chloride.
| Compound Name | [4-[3-[4-[(2S)-2-carboxy-2-ethoxyethyl]phenoxy]propyl]phenyl]azanium chloride |
|---|---|
| PubChem CID | 69426610 |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | [4-[3-[4-[(2S)-2-carboxy-2-ethoxyethyl]phenoxy]propyl]phenyl]azanium chloride |
| SMILES | CCO[C@@H](Cc1ccc(OCCCc2ccc([NH3+])cc2)cc1)C(=O)O.[Cl-] |
| InChI | InChI=1S/C20H25NO4.ClH/c1-2-24-19(20(22)23)14-16-7-11-18(12-8-16)25-13-3-4-15-5-9-17(21)10-6-15;/h5-12,19H,2-4,13-14,21H2,1H3,(H,22,23);1H/t19-;/m0./s1 |
| InChIKey | DIGDJJZXAVLRPA-FYZYNONXSA-N |
| XLogP | -0.39 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|