C26H27NO4 — CID 70120871
(2S)-3-[4-(3-carbazol-9-ylpropoxy)phenyl]-2-ethoxypropanoic acid (PubChem CID 70120871) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2S)-3-[4-(3-carbazol-9-ylpropoxy)phenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-(3-carbazol-9-ylpropoxy)phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 70120871 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (2S)-3-[4-(3-carbazol-9-ylpropoxy)phenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OCCCn2c3ccccc3c3ccccc32)cc1)C(=O)O |
| InChI | InChI=1S/C26H27NO4/c1-2-30-25(26(28)29)18-19-12-14-20(15-13-19)31-17-7-16-27-23-10-5-3-8-21(23)22-9-4-6-11-24(22)27/h3-6,8-15,25H,2,7,16-18H2,1H3,(H,28,29)/t25-/m0/s1 |
| InChIKey | ORMIFAQTQPWPSB-VWLOTQADSA-N |
| XLogP | 5.30 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|