C26H28N2O4 — CID 11729721
ethyl (2S)-2-ethoxy-3-[4-(2-pyrido[3,4-b]indol-9-ylethoxy)phenyl]propanoate (PubChem CID 11729721) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is ethyl (2S)-2-ethoxy-3-[4-(2-pyrido[3,4-b]indol-9-ylethoxy)phenyl]propanoate.
| Compound Name | ethyl (2S)-2-ethoxy-3-[4-(2-pyrido[3,4-b]indol-9-ylethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 11729721 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | ethyl (2S)-2-ethoxy-3-[4-(2-pyrido[3,4-b]indol-9-ylethoxy)phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OCCn2c3ccccc3c3ccncc32)cc1)OCC |
| InChI | InChI=1S/C26H28N2O4/c1-3-30-25(26(29)31-4-2)17-19-9-11-20(12-10-19)32-16-15-28-23-8-6-5-7-21(23)22-13-14-27-18-24(22)28/h5-14,18,25H,3-4,15-17H2,1-2H3/t25-/m0/s1 |
| InChIKey | BEKNPMOLLVBFHO-VWLOTQADSA-N |
| XLogP | 4.78 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |