C24H29N2O4+ — CID 163795770
[2-ethoxy-3-[4-[2-(2-methyl-5-phenylpyrrol-1-yl)ethoxy]phenyl]propanoyl]oxyazanium (PubChem CID 163795770) has the molecular formula C24H29N2O4+ and a molecular weight of 409.51 g/mol. Its IUPAC name is [2-ethoxy-3-[4-[2-(2-methyl-5-phenylpyrrol-1-yl)ethoxy]phenyl]propanoyl]oxyazanium.
| Compound Name | [2-ethoxy-3-[4-[2-(2-methyl-5-phenylpyrrol-1-yl)ethoxy]phenyl]propanoyl]oxyazanium |
|---|---|
| PubChem CID | 163795770 |
| Molecular Formula | C24H29N2O4+ |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | [2-ethoxy-3-[4-[2-(2-methyl-5-phenylpyrrol-1-yl)ethoxy]phenyl]propanoyl]oxyazanium |
| SMILES | CCOC(Cc1ccc(OCCn2c(C)ccc2-c2ccccc2)cc1)C(=O)O[NH3+] |
| InChI | InChI=1S/C24H29N2O4/c1-3-28-23(24(27)30-25)17-19-10-12-21(13-11-19)29-16-15-26-18(2)9-14-22(26)20-7-5-4-6-8-20/h4-14,23H,3,15-17H2,1-2,25H3/q+1 |
| InChIKey | NAQCRZXTBQCMDS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|