C25H29NO4 — CID 22168738
methyl 2-ethoxy-3-[4-[2-(2-methyl-5-phenylpyrrol-1-yl)ethoxy]phenyl]propanoate (PubChem CID 22168738) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is methyl 2-ethoxy-3-[4-[2-(2-methyl-5-phenylpyrrol-1-yl)ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-ethoxy-3-[4-[2-(2-methyl-5-phenylpyrrol-1-yl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 22168738 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | methyl 2-ethoxy-3-[4-[2-(2-methyl-5-phenylpyrrol-1-yl)ethoxy]phenyl]propanoate |
| SMILES | CCOC(Cc1ccc(OCCn2c(C)ccc2-c2ccccc2)cc1)C(=O)OC |
| InChI | InChI=1S/C25H29NO4/c1-4-29-24(25(27)28-3)18-20-11-13-22(14-12-20)30-17-16-26-19(2)10-15-23(26)21-8-6-5-7-9-21/h5-15,24H,4,16-18H2,1-3H3 |
| InChIKey | AVOUNJCTGQSWSX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|