C26H31NO4 — CID 144802895
2-(ethoxymethyl)-3-[4-[2-[2-methyl-5-(4-methylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoic acid (PubChem CID 144802895) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 2-(ethoxymethyl)-3-[4-[2-[2-methyl-5-(4-methylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-(ethoxymethyl)-3-[4-[2-[2-methyl-5-(4-methylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 144802895 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 2-(ethoxymethyl)-3-[4-[2-[2-methyl-5-(4-methylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoic acid |
| SMILES | CCOCC(Cc1ccc(OCCn2c(C)ccc2-c2ccc(C)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H31NO4/c1-4-30-18-23(26(28)29)17-21-8-12-24(13-9-21)31-16-15-27-20(3)7-14-25(27)22-10-5-19(2)6-11-22/h5-14,23H,4,15-18H2,1-3H3,(H,28,29) |
| InChIKey | GMJFRUFJCHJRCK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|