C25H31NO4S — CID 145135992
ethanol;3-[4-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoic acid (PubChem CID 145135992) has the molecular formula C25H31NO4S and a molecular weight of 441.59 g/mol. Its IUPAC name is ethanol;3-[4-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoic acid.
| Compound Name | ethanol;3-[4-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 145135992 |
| Molecular Formula | C25H31NO4S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | ethanol;3-[4-[2-[2-methyl-5-(4-methylsulfanylphenyl)pyrrol-1-yl]ethoxy]phenyl]propanoic acid |
| SMILES | CCO.CSc1ccc(-c2ccc(C)n2CCOc2ccc(CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H25NO3S.C2H6O/c1-17-3-13-22(19-7-11-21(28-2)12-8-19)24(17)15-16-27-20-9-4-18(5-10-20)6-14-23(25)26;1-2-3/h3-5,7-13H,6,14-16H2,1-2H3,(H,25,26);3H,2H2,1H3 |
| InChIKey | KKNUOLLXYHTZFZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|