C21H19ClFNO3 — CID 3637763
3-[5-(4-chlorophenyl)-1-[2-(4-fluorophenoxy)ethyl]pyrrol-2-yl]propanoic acid (PubChem CID 3637763) has the molecular formula C21H19ClFNO3 and a molecular weight of 387.84 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1-[2-(4-fluorophenoxy)ethyl]pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[5-(4-chlorophenyl)-1-[2-(4-fluorophenoxy)ethyl]pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 3637763 |
| Molecular Formula | C21H19ClFNO3 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1-[2-(4-fluorophenoxy)ethyl]pyrrol-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(-c2ccc(Cl)cc2)n1CCOc1ccc(F)cc1 |
| InChI | InChI=1S/C21H19ClFNO3/c22-16-3-1-15(2-4-16)20-11-7-18(8-12-21(25)26)24(20)13-14-27-19-9-5-17(23)6-10-19/h1-7,9-11H,8,12-14H2,(H,25,26) |
| InChIKey | PUJJPZQQKDIDHU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|