C24H26ClNO3 — CID 3888067
3-[5-(4-chlorophenyl)-1-[2-(2,4,6-trimethylphenoxy)ethyl]pyrrol-2-yl]propanoic acid (PubChem CID 3888067) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1-[2-(2,4,6-trimethylphenoxy)ethyl]pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[5-(4-chlorophenyl)-1-[2-(2,4,6-trimethylphenoxy)ethyl]pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 3888067 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1-[2-(2,4,6-trimethylphenoxy)ethyl]pyrrol-2-yl]propanoic acid |
| SMILES | Cc1cc(C)c(OCCn2c(CCC(=O)O)ccc2-c2ccc(Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C24H26ClNO3/c1-16-14-17(2)24(18(3)15-16)29-13-12-26-21(9-11-23(27)28)8-10-22(26)19-4-6-20(25)7-5-19/h4-8,10,14-15H,9,11-13H2,1-3H3,(H,27,28) |
| InChIKey | JOMWXRNCFPHCGD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|