C17H17ClNO4- — CID 4592176
3-[5-(4-chlorophenyl)-1-(2-ethoxy-2-oxoethyl)pyrrol-2-yl]propanoate (PubChem CID 4592176) has the molecular formula C17H17ClNO4- and a molecular weight of 334.78 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1-(2-ethoxy-2-oxoethyl)pyrrol-2-yl]propanoate.
| Compound Name | 3-[5-(4-chlorophenyl)-1-(2-ethoxy-2-oxoethyl)pyrrol-2-yl]propanoate |
|---|---|
| PubChem CID | 4592176 |
| Molecular Formula | C17H17ClNO4- |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1-(2-ethoxy-2-oxoethyl)pyrrol-2-yl]propanoate |
| SMILES | CCOC(=O)Cn1c(CCC(=O)[O-])ccc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClNO4/c1-2-23-17(22)11-19-14(8-10-16(20)21)7-9-15(19)12-3-5-13(18)6-4-12/h3-7,9H,2,8,10-11H2,1H3,(H,20,21)/p-1 |
| InChIKey | BZKZFMMSXHQECA-UHFFFAOYSA-M |
| XLogP | 2.05 |
| TPSA | 71.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|