C19H15Cl2NO3 — CID 3949350
3-[1-(5-chloro-2-hydroxyphenyl)-5-(4-chlorophenyl)pyrrol-2-yl]propanoic acid (PubChem CID 3949350) has the molecular formula C19H15Cl2NO3 and a molecular weight of 376.24 g/mol. Its IUPAC name is 3-[1-(5-chloro-2-hydroxyphenyl)-5-(4-chlorophenyl)pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[1-(5-chloro-2-hydroxyphenyl)-5-(4-chlorophenyl)pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 3949350 |
| Molecular Formula | C19H15Cl2NO3 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 3-[1-(5-chloro-2-hydroxyphenyl)-5-(4-chlorophenyl)pyrrol-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(-c2ccc(Cl)cc2)n1-c1cc(Cl)ccc1O |
| InChI | InChI=1S/C19H15Cl2NO3/c20-13-3-1-12(2-4-13)16-8-6-15(7-10-19(24)25)22(16)17-11-14(21)5-9-18(17)23/h1-6,8-9,11,23H,7,10H2,(H,24,25) |
| InChIKey | VRHFMXKGANGABJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|