C22H23NO5 — CID 1166311
3-[1-(2,5-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrrol-2-yl]propanoic acid (PubChem CID 1166311) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-[1-(2,5-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[1-(2,5-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 1166311 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 3-[1-(2,5-dimethoxyphenyl)-5-(4-methoxyphenyl)pyrrol-2-yl]propanoic acid |
| SMILES | COc1ccc(-c2ccc(CCC(=O)O)n2-c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C22H23NO5/c1-26-17-8-4-15(5-9-17)19-11-6-16(7-13-22(24)25)23(19)20-14-18(27-2)10-12-21(20)28-3/h4-6,8-12,14H,7,13H2,1-3H3,(H,24,25) |
| InChIKey | SJUMAGYDNWCVQP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|