C25H29NO4S — CID 10114122
2-ethoxy-3-[4-[2-[2-methyl-5-[4-(sulfanylmethyl)phenyl]pyrrol-1-yl]ethoxy]phenyl]propanoic acid (PubChem CID 10114122) has the molecular formula C25H29NO4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[2-[2-methyl-5-[4-(sulfanylmethyl)phenyl]pyrrol-1-yl]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[2-[2-methyl-5-[4-(sulfanylmethyl)phenyl]pyrrol-1-yl]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10114122 |
| Molecular Formula | C25H29NO4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-ethoxy-3-[4-[2-[2-methyl-5-[4-(sulfanylmethyl)phenyl]pyrrol-1-yl]ethoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCn2c(C)ccc2-c2ccc(CS)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H29NO4S/c1-3-29-24(25(27)28)16-19-7-11-22(12-8-19)30-15-14-26-18(2)4-13-23(26)21-9-5-20(17-31)6-10-21/h4-13,24,31H,3,14-17H2,1-2H3,(H,27,28) |
| InChIKey | CERHYAFQFWXHIS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|