C30H33NO5 — CID 22168765
methyl 2-ethoxy-3-[6-[2-[2-(4-methoxyphenyl)-5-methylpyrrol-1-yl]ethoxy]naphthalen-2-yl]propanoate (PubChem CID 22168765) has the molecular formula C30H33NO5 and a molecular weight of 487.60 g/mol. Its IUPAC name is methyl 2-ethoxy-3-[6-[2-[2-(4-methoxyphenyl)-5-methylpyrrol-1-yl]ethoxy]naphthalen-2-yl]propanoate.
| Compound Name | methyl 2-ethoxy-3-[6-[2-[2-(4-methoxyphenyl)-5-methylpyrrol-1-yl]ethoxy]naphthalen-2-yl]propanoate |
|---|---|
| PubChem CID | 22168765 |
| Molecular Formula | C30H33NO5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | methyl 2-ethoxy-3-[6-[2-[2-(4-methoxyphenyl)-5-methylpyrrol-1-yl]ethoxy]naphthalen-2-yl]propanoate |
| SMILES | CCOC(Cc1ccc2cc(OCCn3c(C)ccc3-c3ccc(OC)cc3)ccc2c1)C(=O)OC |
| InChI | InChI=1S/C30H33NO5/c1-5-35-29(30(32)34-4)19-22-7-8-25-20-27(14-11-24(25)18-22)36-17-16-31-21(2)6-15-28(31)23-9-12-26(33-3)13-10-23/h6-15,18,20,29H,5,16-17,19H2,1-4H3 |
| InChIKey | VPBZEACYQBFNEH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|