C26H31NO5 — CID 22168762
ethyl 2-ethoxy-3-[4-[2-[2-(4-hydroxyphenyl)-5-methylpyrrol-1-yl]ethoxy]phenyl]propanoate (PubChem CID 22168762) has the molecular formula C26H31NO5 and a molecular weight of 437.54 g/mol. Its IUPAC name is ethyl 2-ethoxy-3-[4-[2-[2-(4-hydroxyphenyl)-5-methylpyrrol-1-yl]ethoxy]phenyl]propanoate.
| Compound Name | ethyl 2-ethoxy-3-[4-[2-[2-(4-hydroxyphenyl)-5-methylpyrrol-1-yl]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 22168762 |
| Molecular Formula | C26H31NO5 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | ethyl 2-ethoxy-3-[4-[2-[2-(4-hydroxyphenyl)-5-methylpyrrol-1-yl]ethoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCCn2c(C)ccc2-c2ccc(O)cc2)cc1)OCC |
| InChI | InChI=1S/C26H31NO5/c1-4-30-25(26(29)31-5-2)18-20-7-13-23(14-8-20)32-17-16-27-19(3)6-15-24(27)21-9-11-22(28)12-10-21/h6-15,25,28H,4-5,16-18H2,1-3H3 |
| InChIKey | GSJUPLYTEIGWGJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|