C57H75N3O12 — CID 160733152
ethyl 2-ethoxy-3-[4-(2-pyrrol-1-ylethoxy)phenyl]propanoate (PubChem CID 160733152) has the molecular formula C57H75N3O12 and a molecular weight of 994.24 g/mol. Its IUPAC name is ethyl 2-ethoxy-3-[4-(2-pyrrol-1-ylethoxy)phenyl]propanoate.
| Compound Name | ethyl 2-ethoxy-3-[4-(2-pyrrol-1-ylethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 160733152 |
| Molecular Formula | C57H75N3O12 |
| Molecular Weight | 994.24 g/mol |
| Exact Mass | 993.54 |
| IUPAC Name | ethyl 2-ethoxy-3-[4-(2-pyrrol-1-ylethoxy)phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCCn2cccc2)cc1)OCC.CCOC(=O)C(Cc1ccc(OCCn2cccc2)cc1)OCC.CCOC(=O)C(Cc1ccc(OCCn2cccc2)cc1)OCC |
| InChI | InChI=1S/3C19H25NO4/c3*1-3-22-18(19(21)23-4-2)15-16-7-9-17(10-8-16)24-14-13-20-11-5-6-12-20/h3*5-12,18H,3-4,13-15H2,1-2H3 |
| InChIKey | RUPJUFVOHVRZFM-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 149.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.24 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|