C24H24N2O4 — CID 70208431
2-ethoxy-2-[4-(2-pyrido[3,4-b]indol-9-ylethoxy)phenyl]propanoic acid (PubChem CID 70208431) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-ethoxy-2-[4-(2-pyrido[3,4-b]indol-9-ylethoxy)phenyl]propanoic acid.
| Compound Name | 2-ethoxy-2-[4-(2-pyrido[3,4-b]indol-9-ylethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 70208431 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-ethoxy-2-[4-(2-pyrido[3,4-b]indol-9-ylethoxy)phenyl]propanoic acid |
| SMILES | CCOC(C)(C(=O)O)c1ccc(OCCn2c3ccccc3c3ccncc32)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-3-30-24(2,23(27)28)17-8-10-18(11-9-17)29-15-14-26-21-7-5-4-6-19(21)20-12-13-25-16-22(20)26/h4-13,16H,3,14-15H2,1-2H3,(H,27,28) |
| InChIKey | SYZWGJXWYUJAPG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |