C25H25NO3S — CID 68953805
2-[4-(2-carbazol-9-ylethoxy)phenyl]sulfanyl-2-methylbutanoic acid (PubChem CID 68953805) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is 2-[4-(2-carbazol-9-ylethoxy)phenyl]sulfanyl-2-methylbutanoic acid.
| Compound Name | 2-[4-(2-carbazol-9-ylethoxy)phenyl]sulfanyl-2-methylbutanoic acid |
|---|---|
| PubChem CID | 68953805 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 2-[4-(2-carbazol-9-ylethoxy)phenyl]sulfanyl-2-methylbutanoic acid |
| SMILES | CCC(C)(Sc1ccc(OCCn2c3ccccc3c3ccccc32)cc1)C(=O)O |
| InChI | InChI=1S/C25H25NO3S/c1-3-25(2,24(27)28)30-19-14-12-18(13-15-19)29-17-16-26-22-10-6-4-8-20(22)21-9-5-7-11-23(21)26/h4-15H,3,16-17H2,1-2H3,(H,27,28) |
| InChIKey | WWEGRDPCSHBDCP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |