C33H32N2O6 — CID 140519929
ethyl 2-[[4-(2-carbazol-9-ylethoxy)phenyl]methyl-(4-methoxyphenoxy)carbonylamino]acetate (PubChem CID 140519929) has the molecular formula C33H32N2O6 and a molecular weight of 552.63 g/mol. Its IUPAC name is ethyl 2-[[4-(2-carbazol-9-ylethoxy)phenyl]methyl-(4-methoxyphenoxy)carbonylamino]acetate.
| Compound Name | ethyl 2-[[4-(2-carbazol-9-ylethoxy)phenyl]methyl-(4-methoxyphenoxy)carbonylamino]acetate |
|---|---|
| PubChem CID | 140519929 |
| Molecular Formula | C33H32N2O6 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | ethyl 2-[[4-(2-carbazol-9-ylethoxy)phenyl]methyl-(4-methoxyphenoxy)carbonylamino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccc(OCCn2c3ccccc3c3ccccc32)cc1)C(=O)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C33H32N2O6/c1-3-39-32(36)23-34(33(37)41-27-18-16-25(38-2)17-19-27)22-24-12-14-26(15-13-24)40-21-20-35-30-10-6-4-8-28(30)29-9-5-7-11-31(29)35/h4-19H,3,20-23H2,1-2H3 |
| InChIKey | LLTWFWNYQYBCSP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |